![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| Public Enemy/ | 2024-03-05 11:38 | - |
| C.U.B.A. Cabbal/ | 2024-03-05 11:38 | - |
| www.anotheroasis.com/ | 2024-03-05 11:38 | - |
| Velvet Underground/ | 2024-03-05 11:38 | - |
| Vasco Rossi/ | 2024-03-05 11:38 | - |
| Various Artists/ | 2024-03-05 11:38 | - |
| Varios intérpretes/ | 2024-03-05 11:38 | - |
| Ultras/ | 2024-03-05 11:38 | - |
| U2/ | 2024-03-05 11:38 | - |
| Tu-Pac, Snoop Doggy Dog/ | 2024-03-05 11:38 | - |
| Tracy Chapman/ | 2024-03-05 11:38 | - |
| The Velvet Underground/ | 2024-03-05 11:38 | - |
| The Stooges/ | 2024-03-05 11:38 | - |
| The Sex Pistols/ | 2024-03-05 11:38 | - |
| The Rolling Stones/ | 2024-03-05 11:38 | - |
| The Calling/ | 2024-03-05 11:38 | - |
| The Beatles/ | 2024-03-05 11:38 | - |
| Statuto/ | 2024-03-05 11:38 | - |
| Sex Pistols/ | 2024-03-05 11:38 | - |
| Ror/ | 2024-03-05 11:37 | - |
| Robbie Williams/ | 2024-03-05 11:37 | - |
| Rino Gaetano/ | 2024-03-05 11:37 | - |
| REM/ | 2024-03-05 11:37 | - |
| Red Hot Chilli Peppers/ | 2024-03-05 11:37 | - |
| Red Hot Chili Peppers/ | 2024-03-05 11:37 | - |
| R.E.M_/ | 2024-03-05 11:37 | - |
| Pink/ | 2024-03-05 11:37 | - |
| PHD/ | 2024-03-05 11:37 | - |
| Pearl Jam/ | 2024-03-05 11:37 | - |
| P!nk/ | 2024-03-05 11:36 | - |
| oasis/ | 2024-03-05 11:36 | - |
| no artist/ | 2024-03-05 11:36 | - |
| Mannarino/ | 2024-03-05 11:36 | - |
| Lucio Dalla/ | 2024-03-05 11:36 | - |
| Lucio Battisti/ | 2024-03-05 11:36 | - |
| Luca Carboni/ | 2024-03-05 11:36 | - |
| Louis Armstrong/ | 2024-03-05 11:36 | - |
| Lorenzo Jovanotti/ | 2024-03-05 11:36 | - |
| Linkin Park/ | 2024-03-05 11:36 | - |
| Ligabue/ | 2024-03-05 11:36 | - |
| Keny Arkana/ | 2024-03-05 11:36 | - |
| Kasabian/ | 2024-03-05 11:36 | - |
| Joy Division/ | 2024-03-05 11:36 | - |
| Jovanotti/ | 2024-03-05 11:36 | - |
| John Lenon/ | 2024-03-05 11:36 | - |
| Jack White & Alicia Keys/ | 2024-03-05 11:36 | - |
| Irish Drinking Songs/ | 2024-03-05 11:36 | - |
| Iggy Pop & The Stooges/ | 2024-03-05 11:36 | - |
| Iggy Pop/ | 2024-03-05 11:36 | - |
| Gym Class Heroes/ | 2024-03-05 11:36 | - |
| Guns Nroses/ | 2024-03-05 11:36 | - |
| Guns N' Roses/ | 2024-03-05 11:36 | - |
| Guns N Roses/ | 2024-03-05 11:36 | - |
| Grezzo D_/ | 2024-03-05 11:36 | - |
| Gorillaz/ | 2024-03-05 11:36 | - |
| Goran Bregovic/ | 2024-03-05 11:36 | - |
| Goo Goo Dolls/ | 2024-03-05 11:36 | - |
| gnr/ | 2024-03-05 11:36 | - |
| Giorgio Gaber/ | 2024-03-05 11:36 | - |
| Giorgia/ | 2024-03-05 11:36 | - |
| Gianna Nannini/ | 2024-03-05 11:36 | - |
| General Levy/ | 2024-03-05 11:36 | - |
| Frankie Hi-NRG MC/ | 2024-03-05 11:36 | - |
| Frank Sinatra/ | 2024-03-05 11:36 | - |
| Francesco Guccini/ | 2024-03-05 11:36 | - |
| Francesco De Gregori/ | 2024-03-05 11:36 | - |
| Fort Minor/ | 2024-03-05 11:36 | - |
| Foo Fighters/ | 2024-03-05 11:36 | - |
| Fiorella Mannoia/ | 2024-03-05 11:36 | - |
| Fatboy Slim/ | 2024-03-05 11:36 | - |
| Fat Boy Slim/ | 2024-03-05 11:36 | - |
| Fabrizio De André/ | 2024-03-05 11:36 | - |
| Fabrizio De Andrè/ | 2024-03-05 11:36 | - |
| Eminem/ | 2024-03-05 11:36 | - |
| Duffy/ | 2024-03-05 11:36 | - |
| Dropkick Murphys/ | 2024-03-05 11:36 | - |
| Depeche Mode/ | 2024-03-05 11:36 | - |
| Deep Purple/ | 2024-03-05 11:36 | - |
| Daft Punk/ | 2024-03-05 11:36 | - |
| Cypress Hill/ | 2024-03-05 11:36 | - |
| Culture Club/ | 2024-03-05 11:36 | - |
| Colle Der Fomento/ | 2024-03-05 11:36 | - |
| Coldplay/ | 2024-03-05 11:36 | - |
| Chemical Brothers/ | 2024-03-05 11:36 | - |
| CapaRezza/ | 2024-03-05 11:36 | - |
| Busta Rhymes/ | 2024-03-05 11:36 | - |
| Buggles/ | 2024-03-05 11:36 | - |
| Bob Marley/ | 2024-03-05 11:36 | - |
| Blur/ | 2024-03-05 11:36 | - |
| Blasco/ | 2024-03-05 11:35 | - |
| Beatles/ | 2024-03-05 11:35 | - |
| Banda Bassotti/ | 2024-03-05 11:35 | - |
| Banco del mutuo socorso/ | 2024-03-05 11:35 | - |
| Banco del Mutuo Soccorso/ | 2024-03-05 11:35 | - |
| Baccini/ | 2024-03-05 11:35 | - |
| Artisti Vari/ | 2024-03-05 11:35 | - |
| Artista sconosciuto/ | 2024-03-05 11:35 | - |
| artist/ | 2024-03-05 11:35 | - |
| Articolo 31/ | 2024-03-05 11:35 | - |
| Appleton/ | 2024-03-05 11:35 | - |
| Apollo 440/ | 2024-03-05 11:35 | - |
| Antonello Venditti/ | 2024-03-05 11:35 | - |
| Andrea Bocelli - Laura Pausini/ | 2024-03-05 11:35 | - |
| Alessandro Mannarino/ | 2024-03-05 11:35 | - |
| Alan Sorrenti/ | 2024-03-05 11:35 | - |
| Ace Of Base/ | 2024-03-05 11:35 | - |
| 2Pac/ | 2024-03-05 11:35 | - |