![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| 10 The Final Day.mp3 | 1980-01-01 00:00 | 9.2M |
| 09 A Long, Long Way.mp3 | 1980-01-01 00:00 | 5.6M |
| 08 Coming Home.mp3 | 1980-01-01 00:00 | 7.0M |
| 07 The Fear.mp3 | 1980-01-01 00:00 | 9.7M |
| 06 Forsaken Cowboy.mp3 | 1980-01-01 00:00 | 7.6M |
| 05 The Drug.mp3 | 1980-01-01 00:00 | 8.2M |
| 04 Senior Living.mp3 | 1980-01-01 00:00 | 7.1M |
| 03 The Alcoholic.mp3 | 1980-01-01 00:00 | 7.2M |
| 02 Tricky Two.mp3 | 1980-01-01 00:00 | 11M |
| 01 ....And the Forest Began to Sing.mp3 | 1980-01-01 00:00 | 2.6M |