![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| sparklehorse-sick of goodbyes.ogg | 2024-11-17 23:29 | 3.4M |
| folkone/ | 2024-03-05 13:56 | - |
| Neil_Young_-_Keep_on_Rocking_in_the_Free_World.mp3 | 1980-01-01 00:00 | 4.3M |
| 14 Why Did You Put Me On.mp3 | 1980-01-01 00:00 | 3.7M |
| 12 Stranger in a Strange Land.mp3 | 1980-01-01 00:00 | 3.4M |
| 12 I'm a Good Woman.mp3 | 1980-01-01 00:00 | 5.9M |
| 07 Sleeping Dead.mp3 | 1980-01-01 00:00 | 5.5M |
| 05 pumping (my heart) patti smith.mp3 | 1980-01-01 00:00 | 4.6M |
| 05 moon in the gutter-jack rose.mp3 | 1980-01-01 00:00 | 4.2M |
| 05 Can't Come Down.mp3 | 1980-01-01 00:00 | 4.2M |
| 03 woodpiles on the side of the road-jack rose.mp3 | 1980-01-01 00:00 | 4.4M |
| 03 You Were on My Mind.mp3 | 1980-01-01 00:00 | 3.6M |
| 03 81-newsom have one on me.mp3 | 1980-01-01 00:00 | 5.3M |
| 01 Psychotic Reaction.mp3 | 1980-01-01 00:00 | 4.3M |