![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| stealther.mp3 | 1980-01-01 00:00 | 30M |
| industry-alone.mp3 | 1980-01-01 00:00 | 6.4M |
| fullhate-itsyours-rmx.mp3 | 1980-01-01 00:00 | 3.4M |
| fhl-pd003_12_ivanetto_peak.mp3 | 1980-01-01 00:00 | 4.5M |
| fhl-pd003_01_ivanetto_ripijate.mp3 | 1980-01-01 00:00 | 3.0M |
| fhl-pd002_17_tiron_wow.mp3 | 1980-01-01 00:00 | 2.0M |
| eddi - chi ha paura.mp3 | 1980-01-01 00:00 | 7.2M |
| Liska - ESSISONO.MP3 | 1980-01-01 00:00 | 3.1M |
| Drast-x - Street antagonist.mp3 | 1980-01-01 00:00 | 6.8M |
| Degrader - Like a pig.mp3 | 1980-01-01 00:00 | 5.6M |
| 05-pekino-fridge.mp3 | 1980-01-01 00:00 | 6.8M |
| 02 one of the crew.mp3 | 1980-01-01 00:00 | 11M |