![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| folder.jpg | 1980-01-01 00:00 | 69K |
| 09 Just another night.mp3 | 1980-01-01 00:00 | 10M |
| 08 Nightingale.mp3 | 1980-01-01 00:00 | 6.7M |
| 07 Both ends burning.mp3 | 1980-01-01 00:00 | 8.4M |
| 06 Could in happen to me.mp3 | 1980-01-01 00:00 | 5.8M |
| 05 She shells.mp3 | 1980-01-01 00:00 | 5.9M |
| 04 Whirlwind.mp3 | 1980-01-01 00:00 | 5.8M |
| 03 Sentimental fool.mp3 | 1980-01-01 00:00 | 10M |
| 02 End of the line.mp3 | 1980-01-01 00:00 | 8.4M |
| 01 Love is the drug.mp3 | 1980-01-01 00:00 | 6.7M |