![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size |
|---|---|---|---|
| Parent Directory | - | |
| folder.jpg | 1980-01-01 00:00 | 69K |
| 12 Stations Of The Mind.mp3 | 1980-01-01 00:00 | 8.2M |
| 11 Diminishing Point.mp3 | 1980-01-01 00:00 | 6.8M |
| 10 E-Wave.mp3 | 1980-01-01 00:00 | 6.6M |
| 09 The Operators.mp3 | 1980-01-01 00:00 | 9.5M |
| 08 The Inversion.mp3 | 1980-01-01 00:00 | 10M |
| 07 Stills Of Emotion.mp3 | 1980-01-01 00:00 | 7.6M |
| 06 Delta Machines.mp3 | 1980-01-01 00:00 | 7.4M |
| 05 Chemical.mp3 | 1980-01-01 00:00 | 8.8M |
| 04 Sound Sweep.mp3 | 1980-01-01 00:00 | 8.4M |
| 03 The Presence.mp3 | 1980-01-01 00:00 | 6.0M |
| 02 Cycom.mp3 | 1980-01-01 00:00 | 5.9M |
| 01 The Sensual Engine.mp3 | 1980-01-01 00:00 | 8.8M |